C6H6Cl3F3O3 — CID 163274286
2,2,2-trichloroethyl (3R)-4,4,4-trifluoro-3-hydroxybutanoate (PubChem CID 163274286) has the molecular formula C6H6Cl3F3O3 and a molecular weight of 289.46 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (3R)-4,4,4-trifluoro-3-hydroxybutanoate.
| Compound Name | 2,2,2-trichloroethyl (3R)-4,4,4-trifluoro-3-hydroxybutanoate |
|---|---|
| PubChem CID | 163274286 |
| Molecular Formula | C6H6Cl3F3O3 |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 287.93 |
| IUPAC Name | 2,2,2-trichloroethyl (3R)-4,4,4-trifluoro-3-hydroxybutanoate |
| SMILES | O=C(C[C@@H](O)C(F)(F)F)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H6Cl3F3O3/c7-5(8,9)2-15-4(14)1-3(13)6(10,11)12/h3,13H,1-2H2/t3-/m1/s1 |
| InChIKey | ZUNREDJMCQCLHK-GSVOUGTGSA-N |
| XLogP | 2.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|