C16H15Cl2N3O — CID 879759
(2,4-dichlorophenyl)-(4-pyridin-2-ylpiperazin-1-yl)methanone (PubChem CID 879759) has the molecular formula C16H15Cl2N3O and a molecular weight of 336.22 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-(4-pyridin-2-ylpiperazin-1-yl)methanone.
| Compound Name | (2,4-dichlorophenyl)-(4-pyridin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 879759 |
| Molecular Formula | C16H15Cl2N3O |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | (2,4-dichlorophenyl)-(4-pyridin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1Cl)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C16H15Cl2N3O/c17-12-4-5-13(14(18)11-12)16(22)21-9-7-20(8-10-21)15-3-1-2-6-19-15/h1-6,11H,7-10H2 |
| InChIKey | LLKNJUWGIBHQFW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |