C10H12F2N2O2 — CID 87976665
2-cyclopropyl-4-(2,2-difluoroethoxy)-6-methoxypyrimidine (PubChem CID 87976665) has the molecular formula C10H12F2N2O2 and a molecular weight of 230.21 g/mol. Its IUPAC name is 2-cyclopropyl-4-(2,2-difluoroethoxy)-6-methoxypyrimidine.
| Compound Name | 2-cyclopropyl-4-(2,2-difluoroethoxy)-6-methoxypyrimidine |
|---|---|
| PubChem CID | 87976665 |
| Molecular Formula | C10H12F2N2O2 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-cyclopropyl-4-(2,2-difluoroethoxy)-6-methoxypyrimidine |
| SMILES | COc1cc(OCC(F)F)nc(C2CC2)n1 |
| InChI | InChI=1S/C10H12F2N2O2/c1-15-8-4-9(16-5-7(11)12)14-10(13-8)6-2-3-6/h4,6-7H,2-3,5H2,1H3 |
| InChIKey | QKRHWEZYHXFFCI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |