C22H42N4O8 — CID 87982353
3-[1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid (PubChem CID 87982353) has the molecular formula C22H42N4O8 and a molecular weight of 490.60 g/mol. Its IUPAC name is 3-[1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid.
| Compound Name | 3-[1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid |
|---|---|
| PubChem CID | 87982353 |
| Molecular Formula | C22H42N4O8 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.30 |
| IUPAC Name | 3-[1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid |
| SMILES | CC(C)(C)OC(=O)NCC(CNC(=O)OC(C)(C)C)N(CCCNC(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H42N4O8/c1-20(2,3)32-17(29)24-13-15(14-25-18(30)33-21(4,5)6)26(12-10-11-23-16(27)28)19(31)34-22(7,8)9/h15,23H,10-14H2,1-9H3,(H,24,29)(H,25,30)(H,27,28) |
| InChIKey | HTNQYRODNLBFCR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 155.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|