C24H27FN4O3S — CID 87990767
N-[[(5S)-3-[4-[6-(benzylamino)-3-azabicyclo[3.1.0]hexan-3-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylsulfanyl]acetamide (PubChem CID 87990767) has the molecular formula C24H27FN4O3S and a molecular weight of 470.57 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[6-(benzylamino)-3-azabicyclo[3.1.0]hexan-3-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylsulfanyl]acetamide.
| Compound Name | N-[[(5S)-3-[4-[6-(benzylamino)-3-azabicyclo[3.1.0]hexan-3-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 87990767 |
| Molecular Formula | C24H27FN4O3S |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | N-[[(5S)-3-[4-[6-(benzylamino)-3-azabicyclo[3.1.0]hexan-3-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylsulfanyl]acetamide |
| SMILES | CC(=O)NSC[C@@H]1CN(c2ccc(N3CC4C(C3)C4NCc3ccccc3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C24H27FN4O3S/c1-15(30)27-33-14-18-11-29(24(31)32-18)17-7-8-22(21(25)9-17)28-12-19-20(13-28)23(19)26-10-16-5-3-2-4-6-16/h2-9,18-20,23,26H,10-14H2,1H3,(H,27,30)/t18-,19?,20?,23?/m0/s1 |
| InChIKey | ICDWSZASDVKIHR-VJWVULDSSA-N |
| XLogP | 3.16 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|