C29H22Cl2F5N5O4SSi — CID 87991454
bis(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)silane;4-chloro-N-(2-chloro-4-nitrophenyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 87991454) has the molecular formula C29H22Cl2F5N5O4SSi and a molecular weight of 730.57 g/mol. Its IUPAC name is bis(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)silane;4-chloro-N-(2-chloro-4-nitrophenyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | bis(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)silane;4-chloro-N-(2-chloro-4-nitrophenyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 87991454 |
| Molecular Formula | C29H22Cl2F5N5O4SSi |
| Molecular Weight | 730.57 g/mol |
| Exact Mass | 729.05 |
| IUPAC Name | bis(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)silane;4-chloro-N-(2-chloro-4-nitrophenyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | C[Si](Cn1cncn1)(c1ccc(F)cc1)c1ccc(F)cc1.O=[N+]([O-])c1ccc(NS(=O)(=O)c2ccc(Cl)c(C(F)(F)F)c2)c(Cl)c1 |
| InChI | InChI=1S/C16H15F2N3Si.C13H7Cl2F3N2O4S/c1-22(12-21-11-19-10-20-21,15-6-2-13(17)3-7-15)16-8-4-14(18)5-9-16;14-10-3-2-8(6-9(10)13(16,17)18)25(23,24)19-12-4-1-7(20(21)22)5-11(12)15/h2-11H,12H2,1H3;1-6,19H |
| InChIKey | NWDKQGQJDBYNMR-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.57 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|