C12H26O2 — CID 87995402
(2S)-1-tert-butylperoxy-2,5-dimethylhexane (PubChem CID 87995402) has the molecular formula C12H26O2 and a molecular weight of 202.34 g/mol. Its IUPAC name is (2S)-1-tert-butylperoxy-2,5-dimethylhexane.
| Compound Name | (2S)-1-tert-butylperoxy-2,5-dimethylhexane |
|---|---|
| PubChem CID | 87995402 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | (2S)-1-tert-butylperoxy-2,5-dimethylhexane |
| SMILES | CC(C)CC[C@H](C)COOC(C)(C)C |
| InChI | InChI=1S/C12H26O2/c1-10(2)7-8-11(3)9-13-14-12(4,5)6/h10-11H,7-9H2,1-6H3/t11-/m0/s1 |
| InChIKey | PNJLSKTVCRNRBO-NSHDSACASA-N |
| XLogP | 3.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|