C19H17F2NO3S — CID 8815415
N-[2-[4-(difluoromethoxy)phenyl]ethyl]naphthalene-2-sulfonamide (PubChem CID 8815415) has the molecular formula C19H17F2NO3S and a molecular weight of 377.41 g/mol. Its IUPAC name is N-[2-[4-(difluoromethoxy)phenyl]ethyl]naphthalene-2-sulfonamide.
| Compound Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 8815415 |
| Molecular Formula | C19H17F2NO3S |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NCCc1ccc(OC(F)F)cc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H17F2NO3S/c20-19(21)25-17-8-5-14(6-9-17)11-12-22-26(23,24)18-10-7-15-3-1-2-4-16(15)13-18/h1-10,13,19,22H,11-12H2 |
| InChIKey | LGICJFQTRLZPTC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |