C16H27N3O2S2 — CID 8818172
[2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] N,N-diethylcarbamodithioate (PubChem CID 8818172) has the molecular formula C16H27N3O2S2 and a molecular weight of 357.55 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] N,N-diethylcarbamodithioate.
| Compound Name | [2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 8818172 |
| Molecular Formula | C16H27N3O2S2 |
| Molecular Weight | 357.55 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC(=O)NC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C16H27N3O2S2/c1-3-19(4-2)16(22)23-12-14(20)18-15(21)17-11-10-13-8-6-5-7-9-13/h8H,3-7,9-12H2,1-2H3,(H2,17,18,20,21) |
| InChIKey | ITQZKYRRVSJUQB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.55 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|