C23H25N2O3S+ — CID 8827916
ethyl 2-[[(2R)-2-(2,3-dimethylpyridin-1-ium-1-yl)propanoyl]amino]-5-phenylthiophene-3-carboxylate (PubChem CID 8827916) has the molecular formula C23H25N2O3S+ and a molecular weight of 409.53 g/mol. Its IUPAC name is ethyl 2-[[(2R)-2-(2,3-dimethylpyridin-1-ium-1-yl)propanoyl]amino]-5-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(2R)-2-(2,3-dimethylpyridin-1-ium-1-yl)propanoyl]amino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 8827916 |
| Molecular Formula | C23H25N2O3S+ |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | ethyl 2-[[(2R)-2-(2,3-dimethylpyridin-1-ium-1-yl)propanoyl]amino]-5-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)sc1NC(=O)[C@@H](C)[n+]1cccc(C)c1C |
| InChI | InChI=1S/C23H24N2O3S/c1-5-28-23(27)19-14-20(18-11-7-6-8-12-18)29-22(19)24-21(26)17(4)25-13-9-10-15(2)16(25)3/h6-14,17H,5H2,1-4H3/p+1/t17-/m1/s1 |
| InChIKey | CYUOHSAIVAPNLX-QGZVFWFLSA-O |
| XLogP | 4.70 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|