C24H19N2O4+ — CID 8830953
(2S)-2-(3-acetylpyridin-1-ium-1-yl)-N-(9,10-dioxoanthracen-2-yl)propanamide (PubChem CID 8830953) has the molecular formula C24H19N2O4+ and a molecular weight of 399.43 g/mol. Its IUPAC name is (2S)-2-(3-acetylpyridin-1-ium-1-yl)-N-(9,10-dioxoanthracen-2-yl)propanamide.
| Compound Name | (2S)-2-(3-acetylpyridin-1-ium-1-yl)-N-(9,10-dioxoanthracen-2-yl)propanamide |
|---|---|
| PubChem CID | 8830953 |
| Molecular Formula | C24H19N2O4+ |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | (2S)-2-(3-acetylpyridin-1-ium-1-yl)-N-(9,10-dioxoanthracen-2-yl)propanamide |
| SMILES | CC(=O)c1ccc[n+]([C@@H](C)C(=O)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C24H18N2O4/c1-14(26-11-5-6-16(13-26)15(2)27)24(30)25-17-9-10-20-21(12-17)23(29)19-8-4-3-7-18(19)22(20)28/h3-14H,1-2H3/p+1/t14-/m0/s1 |
| InChIKey | WMNWOPJQNHMOEC-AWEZNQCLSA-O |
| XLogP | 3.15 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|