C22H17N2O4+ — CID 8773614
(2S)-N-(9,10-dioxoanthracen-2-yl)-2-(3-hydroxypyridin-1-ium-1-yl)propanamide (PubChem CID 8773614) has the molecular formula C22H17N2O4+ and a molecular weight of 373.39 g/mol. Its IUPAC name is (2S)-N-(9,10-dioxoanthracen-2-yl)-2-(3-hydroxypyridin-1-ium-1-yl)propanamide.
| Compound Name | (2S)-N-(9,10-dioxoanthracen-2-yl)-2-(3-hydroxypyridin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 8773614 |
| Molecular Formula | C22H17N2O4+ |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | (2S)-N-(9,10-dioxoanthracen-2-yl)-2-(3-hydroxypyridin-1-ium-1-yl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O)[n+]1cccc(O)c1 |
| InChI | InChI=1S/C22H16N2O4/c1-13(24-10-4-5-15(25)12-24)22(28)23-14-8-9-18-19(11-14)21(27)17-7-3-2-6-16(17)20(18)26/h2-13H,1H3,(H-,23,25,26,28)/p+1/t13-/m0/s1 |
| InChIKey | ZHPYHWFRXQKHJZ-ZDUSSCGKSA-O |
| XLogP | 2.65 |
| TPSA | 87.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|