C19H21NO4 — CID 8833865
(E)-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N-ethyl-3-(5-methylfuran-2-yl)prop-2-enamide (PubChem CID 8833865) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is (E)-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N-ethyl-3-(5-methylfuran-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N-ethyl-3-(5-methylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 8833865 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (E)-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N-ethyl-3-(5-methylfuran-2-yl)prop-2-enamide |
| SMILES | CCN(Cc1ccc2c(c1)OCCO2)C(=O)/C=C/c1ccc(C)o1 |
| InChI | InChI=1S/C19H21NO4/c1-3-20(19(21)9-7-16-6-4-14(2)24-16)13-15-5-8-17-18(12-15)23-11-10-22-17/h4-9,12H,3,10-11,13H2,1-2H3/b9-7+ |
| InChIKey | UYQSZQOMTABENM-VQHVLOKHSA-N |
| XLogP | 3.42 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|