C13H12FN3O4S — CID 8842983
N'-(2-fluorophenyl)sulfonyl-2-(2-oxo-1-pyridinyl)acetohydrazide (PubChem CID 8842983) has the molecular formula C13H12FN3O4S and a molecular weight of 325.32 g/mol. Its IUPAC name is N'-(2-fluorophenyl)sulfonyl-2-(2-oxo-1-pyridinyl)acetohydrazide.
| Compound Name | N'-(2-fluorophenyl)sulfonyl-2-(2-oxo-1-pyridinyl)acetohydrazide |
|---|---|
| PubChem CID | 8842983 |
| Molecular Formula | C13H12FN3O4S |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | N'-(2-fluorophenyl)sulfonyl-2-(2-oxo-1-pyridinyl)acetohydrazide |
| SMILES | O=C(Cn1ccccc1=O)NNS(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C13H12FN3O4S/c14-10-5-1-2-6-11(10)22(20,21)16-15-12(18)9-17-8-4-3-7-13(17)19/h1-8,16H,9H2,(H,15,18) |
| InChIKey | JUJGWNWHWHBWST-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|