About 1-cyclohexyl-4-oxa-1-azoniabicyclo[3.1.0]hexane;methane
1-cyclohexyl-4-oxa-1-azoniabicyclo[3.1.0]hexane;methane (PubChem CID 88503198) has the molecular formula C11H22NO+
and a molecular weight of 184.30 g/mol. Its IUPAC name is 1-cyclohexyl-4-oxa-1-azoniabicyclo[3.1.0]hexane;methane.
Molecular Properties
| Compound Name | 1-cyclohexyl-4-oxa-1-azoniabicyclo[3.1.0]hexane;methane |
| PubChem CID | 88503198 |
| Molecular Formula | C11H22NO+ |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.17 |
| IUPAC Name | 1-cyclohexyl-4-oxa-1-azoniabicyclo[3.1.0]hexane;methane |
| SMILES | C.C1CCC([N+]23CCOC2C3)CC1 |
| InChI | InChI=1S/C10H18NO.CH4/c1-2-4-9(5-3-1)11-6-7-12-10(11)8-11;/h9-10H,1-8H2;1H4/q+1; |
| InChIKey | ONNJKUGHLYMMCE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-4-oxa-1-azoniabicyclo[3.1.0]hexane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-4-oxa-1-azoniabicyclo[3.1.0]hexane;methane?
The IUPAC name of 1-cyclohexyl-4-oxa-1-azoniabicyclo[3.1.0]hexane;methane (CID 88503198) is 1-cyclohexyl-4-oxa-1-azoniabicyclo[3.1.0]hexane;methane.
What is the SMILES notation for 1-cyclohexyl-4-oxa-1-azoniabicyclo[3.1.0]hexane;methane?
The canonical SMILES for 1-cyclohexyl-4-oxa-1-azoniabicyclo[3.1.0]hexane;methane is C.C1CCC([N+]23CCOC2C3)CC1.
What is the InChIKey of 1-cyclohexyl-4-oxa-1-azoniabicyclo[3.1.0]hexane;methane?
The InChIKey is ONNJKUGHLYMMCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18NO.CH4/c1-2-4-9(5-3-1)11-6-7-12-10(11)8-11;/h9-10H,1-8H2;1H4/q+1;.
What are the key properties of 1-cyclohexyl-4-oxa-1-azoniabicyclo[3.1.0]hexane;methane?
1-cyclohexyl-4-oxa-1-azoniabicyclo[3.1.0]hexane;methane has a molecular weight of 184.30 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-4-oxa-1-azoniabicyclo[3.1.0]hexane;methane is sourced from PubChem (CID 88503198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).