C10H18N+ — CID 151841451
spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azetidin-1-ium] (PubChem CID 151841451) has the molecular formula C10H18N+ and a molecular weight of 152.26 g/mol. Its IUPAC name is spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azetidin-1-ium].
| Compound Name | spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azetidin-1-ium] |
|---|---|
| PubChem CID | 151841451 |
| Molecular Formula | C10H18N+ |
| Molecular Weight | 152.26 g/mol |
| Exact Mass | 152.14 |
| IUPAC Name | spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azetidin-1-ium] |
| SMILES | C1CC2CCC(C1)[N+]21CCC1 |
| InChI | InChI=1S/C10H18N/c1-3-9-5-6-10(4-1)11(9)7-2-8-11/h9-10H,1-8H2/q+1 |
| InChIKey | SGSXOXYBVKJQCY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|