C11H20N+ — CID 170413130
(1S,11S)-11-methyl-11-azoniatricyclo[4.4.1.03,11]undecane (PubChem CID 170413130) has the molecular formula C11H20N+ and a molecular weight of 166.29 g/mol. Its IUPAC name is (1S,11S)-11-methyl-11-azoniatricyclo[4.4.1.03,11]undecane.
| Compound Name | (1S,11S)-11-methyl-11-azoniatricyclo[4.4.1.03,11]undecane |
|---|---|
| PubChem CID | 170413130 |
| Molecular Formula | C11H20N+ |
| Molecular Weight | 166.29 g/mol |
| Exact Mass | 166.16 |
| IUPAC Name | (1S,11S)-11-methyl-11-azoniatricyclo[4.4.1.03,11]undecane |
| SMILES | C[N@+]12C3CCCC[C@H]1CC2CC3 |
| InChI | InChI=1S/C11H20N/c1-12-9-4-2-3-5-10(12)8-11(12)7-6-9/h9-11H,2-8H2,1H3/q+1/t9?,10-,11?,12-/m0/s1 |
| InChIKey | WKWRJSMTNQXAAP-ADPBJBESSA-N |
| XLogP | 2.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|