C16H13Cl5O3 — CID 88507380
3,6-dichloro-2-ethyl-4-(2,4,5-trichlorophenyl)benzoic acid;methanol (PubChem CID 88507380) has the molecular formula C16H13Cl5O3 and a molecular weight of 430.54 g/mol. Its IUPAC name is 3,6-dichloro-2-ethyl-4-(2,4,5-trichlorophenyl)benzoic acid;methanol.
| Compound Name | 3,6-dichloro-2-ethyl-4-(2,4,5-trichlorophenyl)benzoic acid;methanol |
|---|---|
| PubChem CID | 88507380 |
| Molecular Formula | C16H13Cl5O3 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 427.93 |
| IUPAC Name | 3,6-dichloro-2-ethyl-4-(2,4,5-trichlorophenyl)benzoic acid;methanol |
| SMILES | CCc1c(Cl)c(-c2cc(Cl)c(Cl)cc2Cl)cc(Cl)c1C(=O)O.CO |
| InChI | InChI=1S/C15H9Cl5O2.CH4O/c1-2-6-13(15(21)22)12(19)4-8(14(6)20)7-3-10(17)11(18)5-9(7)16;1-2/h3-5H,2H2,1H3,(H,21,22);2H,1H3 |
| InChIKey | DPEXABJBPJIMIL-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|