C24H26N2O5 — CID 88512522
phenyl 3-[(E)-3-[[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]amino]prop-2-enoxy]propanoate (PubChem CID 88512522) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is phenyl 3-[(E)-3-[[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]amino]prop-2-enoxy]propanoate.
| Compound Name | phenyl 3-[(E)-3-[[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]amino]prop-2-enoxy]propanoate |
|---|---|
| PubChem CID | 88512522 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | phenyl 3-[(E)-3-[[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]amino]prop-2-enoxy]propanoate |
| SMILES | CC1(C)Oc2ccc(C#N)cc2[C@@H](N/C=C/COCCC(=O)Oc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C24H26N2O5/c1-24(2)23(28)22(19-15-17(16-25)9-10-20(19)31-24)26-12-6-13-29-14-11-21(27)30-18-7-4-3-5-8-18/h3-10,12,15,22-23,26,28H,11,13-14H2,1-2H3/b12-6+/t22-,23+/m1/s1 |
| InChIKey | FVASOINHTONTMQ-NPIYFEBWSA-N |
| XLogP | 3.25 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|