C9H12O9S3 — CID 88519869
[(4-hydroxyphenyl)-bis(methylsulfonyl)methyl] hydrogen sulfate (PubChem CID 88519869) has the molecular formula C9H12O9S3 and a molecular weight of 360.39 g/mol. Its IUPAC name is [(4-hydroxyphenyl)-bis(methylsulfonyl)methyl] hydrogen sulfate.
| Compound Name | [(4-hydroxyphenyl)-bis(methylsulfonyl)methyl] hydrogen sulfate |
|---|---|
| PubChem CID | 88519869 |
| Molecular Formula | C9H12O9S3 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 359.96 |
| IUPAC Name | [(4-hydroxyphenyl)-bis(methylsulfonyl)methyl] hydrogen sulfate |
| SMILES | CS(=O)(=O)C(OS(=O)(=O)O)(c1ccc(O)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C9H12O9S3/c1-19(11,12)9(20(2,13)14,18-21(15,16)17)7-3-5-8(10)6-4-7/h3-6,10H,1-2H3,(H,15,16,17) |
| InChIKey | NKQASVFBLIOXPI-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|