C19H16F3N3O4S — CID 88522810
1-[5,6,7-trifluoro-8-methyl-4-oxo-3-(1,3-thiazol-2-ylcarbamoyl)-1H-quinolin-2-yl]propyl acetate (PubChem CID 88522810) has the molecular formula C19H16F3N3O4S and a molecular weight of 439.42 g/mol. Its IUPAC name is 1-[5,6,7-trifluoro-8-methyl-4-oxo-3-(1,3-thiazol-2-ylcarbamoyl)-1H-quinolin-2-yl]propyl acetate.
| Compound Name | 1-[5,6,7-trifluoro-8-methyl-4-oxo-3-(1,3-thiazol-2-ylcarbamoyl)-1H-quinolin-2-yl]propyl acetate |
|---|---|
| PubChem CID | 88522810 |
| Molecular Formula | C19H16F3N3O4S |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 1-[5,6,7-trifluoro-8-methyl-4-oxo-3-(1,3-thiazol-2-ylcarbamoyl)-1H-quinolin-2-yl]propyl acetate |
| SMILES | CCC(OC(C)=O)c1[nH]c2c(C)c(F)c(F)c(F)c2c(=O)c1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C19H16F3N3O4S/c1-4-9(29-8(3)26)16-11(18(28)25-19-23-5-6-30-19)17(27)10-13(21)14(22)12(20)7(2)15(10)24-16/h5-6,9H,4H2,1-3H3,(H,24,27)(H,23,25,28) |
| InChIKey | LKACIXFZTFUIMA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|