C19H24N2O11S — CID 5234259
[2,3,4,5-tetraacetyloxy-6-oxo-6-(1,3-thiazol-2-ylamino)hexyl] acetate (PubChem CID 5234259) has the molecular formula C19H24N2O11S and a molecular weight of 488.47 g/mol. Its IUPAC name is [2,3,4,5-tetraacetyloxy-6-oxo-6-(1,3-thiazol-2-ylamino)hexyl] acetate.
| Compound Name | [2,3,4,5-tetraacetyloxy-6-oxo-6-(1,3-thiazol-2-ylamino)hexyl] acetate |
|---|---|
| PubChem CID | 5234259 |
| Molecular Formula | C19H24N2O11S |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | [2,3,4,5-tetraacetyloxy-6-oxo-6-(1,3-thiazol-2-ylamino)hexyl] acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C19H24N2O11S/c1-9(22)28-8-14(29-10(2)23)15(30-11(3)24)16(31-12(4)25)17(32-13(5)26)18(27)21-19-20-6-7-33-19/h6-7,14-17H,8H2,1-5H3,(H,20,21,27) |
| InChIKey | HBRSTXUETIPCMB-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 173.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|