About 5-[ethyl(methyl)amino]pent-3-yn-2-yl N-methylcarbamate
5-[ethyl(methyl)amino]pent-3-yn-2-yl N-methylcarbamate (PubChem CID 88525329) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 5-[ethyl(methyl)amino]pent-3-yn-2-yl N-methylcarbamate.
Molecular Properties
| Compound Name | 5-[ethyl(methyl)amino]pent-3-yn-2-yl N-methylcarbamate |
| PubChem CID | 88525329 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 5-[ethyl(methyl)amino]pent-3-yn-2-yl N-methylcarbamate |
| SMILES | CCN(C)CC#CC(C)OC(=O)NC |
| InChI | InChI=1S/C10H18N2O2/c1-5-12(4)8-6-7-9(2)14-10(13)11-3/h9H,5,8H2,1-4H3,(H,11,13) |
| InChIKey | AYOVDJODYVOMTJ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[ethyl(methyl)amino]pent-3-yn-2-yl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[ethyl(methyl)amino]pent-3-yn-2-yl N-methylcarbamate?
The IUPAC name of 5-[ethyl(methyl)amino]pent-3-yn-2-yl N-methylcarbamate (CID 88525329) is 5-[ethyl(methyl)amino]pent-3-yn-2-yl N-methylcarbamate.
What is the SMILES notation for 5-[ethyl(methyl)amino]pent-3-yn-2-yl N-methylcarbamate?
The canonical SMILES for 5-[ethyl(methyl)amino]pent-3-yn-2-yl N-methylcarbamate is CCN(C)CC#CC(C)OC(=O)NC.
What is the InChIKey of 5-[ethyl(methyl)amino]pent-3-yn-2-yl N-methylcarbamate?
The InChIKey is AYOVDJODYVOMTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2/c1-5-12(4)8-6-7-9(2)14-10(13)11-3/h9H,5,8H2,1-4H3,(H,11,13).
What are the key properties of 5-[ethyl(methyl)amino]pent-3-yn-2-yl N-methylcarbamate?
5-[ethyl(methyl)amino]pent-3-yn-2-yl N-methylcarbamate has a molecular weight of 198.27 g/mol, XLogP of 0.69, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[ethyl(methyl)amino]pent-3-yn-2-yl N-methylcarbamate is sourced from PubChem (CID 88525329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).