C8H17N3O3 — CID 89183272
1-[methyl(methylcarbamoyl)amino]propan-2-yl N-methylcarbamate (PubChem CID 89183272) has the molecular formula C8H17N3O3 and a molecular weight of 203.24 g/mol. Its IUPAC name is 1-[methyl(methylcarbamoyl)amino]propan-2-yl N-methylcarbamate.
| Compound Name | 1-[methyl(methylcarbamoyl)amino]propan-2-yl N-methylcarbamate |
|---|---|
| PubChem CID | 89183272 |
| Molecular Formula | C8H17N3O3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-[methyl(methylcarbamoyl)amino]propan-2-yl N-methylcarbamate |
| SMILES | CNC(=O)OC(C)CN(C)C(=O)NC |
| InChI | InChI=1S/C8H17N3O3/c1-6(14-8(13)10-3)5-11(4)7(12)9-2/h6H,5H2,1-4H3,(H,9,12)(H,10,13) |
| InChIKey | OAHXXLXCERVGLP-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |