About S-benzamido 2-phenylethanethioate
S-benzamido 2-phenylethanethioate (PubChem CID 88533970) has the molecular formula C15H13NO2S
and a molecular weight of 271.34 g/mol. Its IUPAC name is S-benzamido 2-phenylethanethioate.
Molecular Properties
| Compound Name | S-benzamido 2-phenylethanethioate |
| PubChem CID | 88533970 |
| Molecular Formula | C15H13NO2S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | S-benzamido 2-phenylethanethioate |
| SMILES | O=C(Cc1ccccc1)SNC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H13NO2S/c17-14(11-12-7-3-1-4-8-12)19-16-15(18)13-9-5-2-6-10-13/h1-10H,11H2,(H,16,18) |
| InChIKey | JBMYKXDKKKWDMZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-benzamido 2-phenylethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-benzamido 2-phenylethanethioate?
The IUPAC name of S-benzamido 2-phenylethanethioate (CID 88533970) is S-benzamido 2-phenylethanethioate.
What is the SMILES notation for S-benzamido 2-phenylethanethioate?
The canonical SMILES for S-benzamido 2-phenylethanethioate is O=C(Cc1ccccc1)SNC(=O)c1ccccc1.
What is the InChIKey of S-benzamido 2-phenylethanethioate?
The InChIKey is JBMYKXDKKKWDMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO2S/c17-14(11-12-7-3-1-4-8-12)19-16-15(18)13-9-5-2-6-10-13/h1-10H,11H2,(H,16,18).
What are the key properties of S-benzamido 2-phenylethanethioate?
S-benzamido 2-phenylethanethioate has a molecular weight of 271.34 g/mol, XLogP of 2.83, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-benzamido 2-phenylethanethioate is sourced from PubChem (CID 88533970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).