C29H41IN4O4S — CID 88536703
[9-ethyl-7-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]phenothiazin-3-ylidene]-bis(2-methoxyethyl)azanium iodide (PubChem CID 88536703) has the molecular formula C29H41IN4O4S and a molecular weight of 668.64 g/mol. Its IUPAC name is [9-ethyl-7-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]phenothiazin-3-ylidene]-bis(2-methoxyethyl)azanium iodide.
| Compound Name | [9-ethyl-7-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]phenothiazin-3-ylidene]-bis(2-methoxyethyl)azanium iodide |
|---|---|
| PubChem CID | 88536703 |
| Molecular Formula | C29H41IN4O4S |
| Molecular Weight | 668.64 g/mol |
| Exact Mass | 668.19 |
| IUPAC Name | [9-ethyl-7-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]phenothiazin-3-ylidene]-bis(2-methoxyethyl)azanium iodide |
| SMILES | CCc1cc(N2CCN(C(=O)OC(C)(C)C)CC2)cc2sc3cc(=[N+](CCOC)CCOC)ccc-3nc12.[I-] |
| InChI | InChI=1S/C29H41N4O4S.HI/c1-7-21-18-23(31-10-12-33(13-11-31)28(34)37-29(2,3)4)20-26-27(21)30-24-9-8-22(19-25(24)38-26)32(14-16-35-5)15-17-36-6;/h8-9,18-20H,7,10-17H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | BPPAUWGXWMPSHV-UHFFFAOYSA-M |
| XLogP | 1.09 |
| TPSA | 67.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.64 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|