C27H38N4O4S — CID 66562440
tert-butyl 4-[7-[bis(2-methoxyethyl)amino]-10H-phenothiazin-3-yl]piperazine-1-carboxylate (PubChem CID 66562440) has the molecular formula C27H38N4O4S and a molecular weight of 514.69 g/mol. Its IUPAC name is tert-butyl 4-[7-[bis(2-methoxyethyl)amino]-10H-phenothiazin-3-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[7-[bis(2-methoxyethyl)amino]-10H-phenothiazin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 66562440 |
| Molecular Formula | C27H38N4O4S |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | tert-butyl 4-[7-[bis(2-methoxyethyl)amino]-10H-phenothiazin-3-yl]piperazine-1-carboxylate |
| SMILES | COCCN(CCOC)c1ccc2c(c1)Sc1cc(N3CCN(C(=O)OC(C)(C)C)CC3)ccc1N2 |
| InChI | InChI=1S/C27H38N4O4S/c1-27(2,3)35-26(32)31-12-10-29(11-13-31)20-6-8-22-24(18-20)36-25-19-21(7-9-23(25)28-22)30(14-16-33-4)15-17-34-5/h6-9,18-19,28H,10-17H2,1-5H3 |
| InChIKey | WKPAKNYLOQBAHX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 66.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |