C27H38N4O2S — CID 90307457
tert-butyl 4-[7-(diethylamino)-1-ethyl-10H-phenothiazin-3-yl]piperazine-1-carboxylate (PubChem CID 90307457) has the molecular formula C27H38N4O2S and a molecular weight of 482.69 g/mol. Its IUPAC name is tert-butyl 4-[7-(diethylamino)-1-ethyl-10H-phenothiazin-3-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[7-(diethylamino)-1-ethyl-10H-phenothiazin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 90307457 |
| Molecular Formula | C27H38N4O2S |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | tert-butyl 4-[7-(diethylamino)-1-ethyl-10H-phenothiazin-3-yl]piperazine-1-carboxylate |
| SMILES | CCc1cc(N2CCN(C(=O)OC(C)(C)C)CC2)cc2c1Nc1ccc(N(CC)CC)cc1S2 |
| InChI | InChI=1S/C27H38N4O2S/c1-7-19-16-21(30-12-14-31(15-13-30)26(32)33-27(4,5)6)18-24-25(19)28-22-11-10-20(17-23(22)34-24)29(8-2)9-3/h10-11,16-18,28H,7-9,12-15H2,1-6H3 |
| InChIKey | KQEXYODZNLPJOK-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |