C18H26BrClN2O4 — CID 20680470
tert-butyl 4-[3-bromo-4-chloro-5-(ethylperoxymethyl)phenyl]piperazine-1-carboxylate (PubChem CID 20680470) has the molecular formula C18H26BrClN2O4 and a molecular weight of 449.77 g/mol. Its IUPAC name is tert-butyl 4-[3-bromo-4-chloro-5-(ethylperoxymethyl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-bromo-4-chloro-5-(ethylperoxymethyl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 20680470 |
| Molecular Formula | C18H26BrClN2O4 |
| Molecular Weight | 449.77 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | tert-butyl 4-[3-bromo-4-chloro-5-(ethylperoxymethyl)phenyl]piperazine-1-carboxylate |
| SMILES | CCOOCc1cc(N2CCN(C(=O)OC(C)(C)C)CC2)cc(Br)c1Cl |
| InChI | InChI=1S/C18H26BrClN2O4/c1-5-24-25-12-13-10-14(11-15(19)16(13)20)21-6-8-22(9-7-21)17(23)26-18(2,3)4/h10-11H,5-9,12H2,1-4H3 |
| InChIKey | NBEVACGJYKZPSF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.77 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|