C20H17NO2 — CID 88537918
15H-cyclopenta[a]phenanthren-3-yl N-ethylcarbamate (PubChem CID 88537918) has the molecular formula C20H17NO2 and a molecular weight of 303.36 g/mol. Its IUPAC name is 15H-cyclopenta[a]phenanthren-3-yl N-ethylcarbamate.
| Compound Name | 15H-cyclopenta[a]phenanthren-3-yl N-ethylcarbamate |
|---|---|
| PubChem CID | 88537918 |
| Molecular Formula | C20H17NO2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 15H-cyclopenta[a]phenanthren-3-yl N-ethylcarbamate |
| SMILES | CCNC(=O)Oc1ccc2c(ccc3c4c(ccc32)C=CC4)c1 |
| InChI | InChI=1S/C20H17NO2/c1-2-21-20(22)23-15-8-11-17-14(12-15)7-10-18-16-5-3-4-13(16)6-9-19(17)18/h3-4,6-12H,2,5H2,1H3,(H,21,22) |
| InChIKey | ZCUAOJBBRYGZGI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|