C12H14N6O — CID 88538246
1-[(6-aminopurin-9-yl)methyl]-4-ethynylpyrrolidin-3-ol (PubChem CID 88538246) has the molecular formula C12H14N6O and a molecular weight of 258.28 g/mol. Its IUPAC name is 1-[(6-aminopurin-9-yl)methyl]-4-ethynylpyrrolidin-3-ol.
| Compound Name | 1-[(6-aminopurin-9-yl)methyl]-4-ethynylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 88538246 |
| Molecular Formula | C12H14N6O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-[(6-aminopurin-9-yl)methyl]-4-ethynylpyrrolidin-3-ol |
| SMILES | C#CC1CN(Cn2cnc3c(N)ncnc32)CC1O |
| InChI | InChI=1S/C12H14N6O/c1-2-8-3-17(4-9(8)19)7-18-6-16-10-11(13)14-5-15-12(10)18/h1,5-6,8-9,19H,3-4,7H2,(H2,13,14,15) |
| InChIKey | QFOONRZPKCDTRS-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|