C22H23ClN6O3S — CID 88540414
N-[3-[5-chloro-2-methoxy-4-methyl-3-(5-methylsulfonyl-3-pyridinyl)phenyl]propyl]-7H-purin-6-amine (PubChem CID 88540414) has the molecular formula C22H23ClN6O3S and a molecular weight of 486.99 g/mol. Its IUPAC name is N-[3-[5-chloro-2-methoxy-4-methyl-3-(5-methylsulfonyl-3-pyridinyl)phenyl]propyl]-7H-purin-6-amine.
| Compound Name | N-[3-[5-chloro-2-methoxy-4-methyl-3-(5-methylsulfonyl-3-pyridinyl)phenyl]propyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 88540414 |
| Molecular Formula | C22H23ClN6O3S |
| Molecular Weight | 486.99 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | N-[3-[5-chloro-2-methoxy-4-methyl-3-(5-methylsulfonyl-3-pyridinyl)phenyl]propyl]-7H-purin-6-amine |
| SMILES | COc1c(CCCNc2ncnc3nc[nH]c23)cc(Cl)c(C)c1-c1cncc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C22H23ClN6O3S/c1-13-17(23)8-14(5-4-6-25-21-19-22(27-11-26-19)29-12-28-21)20(32-2)18(13)15-7-16(10-24-9-15)33(3,30)31/h7-12H,4-6H2,1-3H3,(H2,25,26,27,28,29) |
| InChIKey | JEDXGJQHXTUWQU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.99 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|