C25H22ClF7N6O5 — CID 88540435
N-[3-[5-chloro-3-(5-fluoro-3-pyridinyl)-2-methoxy-4-methylphenyl]propyl]-7H-purin-6-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 88540435) has the molecular formula C25H22ClF7N6O5 and a molecular weight of 654.93 g/mol. Its IUPAC name is N-[3-[5-chloro-3-(5-fluoro-3-pyridinyl)-2-methoxy-4-methylphenyl]propyl]-7H-purin-6-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[3-[5-chloro-3-(5-fluoro-3-pyridinyl)-2-methoxy-4-methylphenyl]propyl]-7H-purin-6-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 88540435 |
| Molecular Formula | C25H22ClF7N6O5 |
| Molecular Weight | 654.93 g/mol |
| Exact Mass | 654.12 |
| IUPAC Name | N-[3-[5-chloro-3-(5-fluoro-3-pyridinyl)-2-methoxy-4-methylphenyl]propyl]-7H-purin-6-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COc1c(CCCNc2ncnc3nc[nH]c23)cc(Cl)c(C)c1-c1cncc(F)c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H20ClFN6O.2C2HF3O2/c1-12-16(22)7-13(19(30-2)17(12)14-6-15(23)9-24-8-14)4-3-5-25-20-18-21(27-10-26-18)29-11-28-20;2*3-2(4,5)1(6)7/h6-11H,3-5H2,1-2H3,(H2,25,26,27,28,29);2*(H,6,7) |
| InChIKey | AHTPQYIIOSAIFY-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 163.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.93 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|