C19H27Cl2N3O4 — CID 88548340
tert-butyl 4-[[2-[(2,5-dichloro-3-pyridinyl)oxy]-2-methylpropanoyl]amino]piperidine-1-carboxylate (PubChem CID 88548340) has the molecular formula C19H27Cl2N3O4 and a molecular weight of 432.35 g/mol. Its IUPAC name is tert-butyl 4-[[2-[(2,5-dichloro-3-pyridinyl)oxy]-2-methylpropanoyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-[(2,5-dichloro-3-pyridinyl)oxy]-2-methylpropanoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 88548340 |
| Molecular Formula | C19H27Cl2N3O4 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | tert-butyl 4-[[2-[(2,5-dichloro-3-pyridinyl)oxy]-2-methylpropanoyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)C(C)(C)Oc2cc(Cl)cnc2Cl)CC1 |
| InChI | InChI=1S/C19H27Cl2N3O4/c1-18(2,3)28-17(26)24-8-6-13(7-9-24)23-16(25)19(4,5)27-14-10-12(20)11-22-15(14)21/h10-11,13H,6-9H2,1-5H3,(H,23,25) |
| InChIKey | OSQDIBBJXQYCPB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|