C36H18O8 — CID 88553763
[2-[16-(2-formyloxybenzoyl)-12,22-dioxahexacyclo[11.7.1.14,20.02,11.03,8.017,21]docosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene-7-carbonyl]phenyl] formate (PubChem CID 88553763) has the molecular formula C36H18O8 and a molecular weight of 578.53 g/mol. Its IUPAC name is [2-[16-(2-formyloxybenzoyl)-12,22-dioxahexacyclo[11.7.1.14,20.02,11.03,8.017,21]docosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene-7-carbonyl]phenyl] formate.
| Compound Name | [2-[16-(2-formyloxybenzoyl)-12,22-dioxahexacyclo[11.7.1.14,20.02,11.03,8.017,21]docosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene-7-carbonyl]phenyl] formate |
|---|---|
| PubChem CID | 88553763 |
| Molecular Formula | C36H18O8 |
| Molecular Weight | 578.53 g/mol |
| Exact Mass | 578.10 |
| IUPAC Name | [2-[16-(2-formyloxybenzoyl)-12,22-dioxahexacyclo[11.7.1.14,20.02,11.03,8.017,21]docosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene-7-carbonyl]phenyl] formate |
| SMILES | O=COc1ccccc1C(=O)c1ccc2oc3ccc4c(C(=O)c5ccccc5OC=O)ccc5oc6ccc1c2c6-c3c54 |
| InChI | InChI=1S/C36H18O8/c37-17-41-25-7-3-1-5-23(25)35(39)21-11-15-27-31-19(21)9-13-29-33(31)34-30(43-27)14-10-20-22(12-16-28(44-29)32(20)34)36(40)24-6-2-4-8-26(24)42-18-38/h1-18H |
| InChIKey | OSKJNJQRJLJTHF-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 113.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.53 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|