About (2-formyloxybenzoyl)azanide;tungsten
(2-formyloxybenzoyl)azanide;tungsten (PubChem CID 155629345) has the molecular formula C8H6NO3W-
and a molecular weight of 347.98 g/mol. Its IUPAC name is (2-formyloxybenzoyl)azanide;tungsten.
Molecular Properties
| Compound Name | (2-formyloxybenzoyl)azanide;tungsten |
| PubChem CID | 155629345 |
| Molecular Formula | C8H6NO3W- |
| Molecular Weight | 347.98 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | (2-formyloxybenzoyl)azanide;tungsten |
| SMILES | [NH-]C(=O)c1ccccc1OC=O.[W] |
| InChI | InChI=1S/C8H7NO3.W/c9-8(11)6-3-1-2-4-7(6)12-5-10;/h1-5H,(H2,9,11);/p-1 |
| InChIKey | KXQQVAYHWJEFMS-UHFFFAOYSA-M |
| XLogP | 1.41 |
| TPSA | 67.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.98 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2-formyloxybenzoyl)azanide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-formyloxybenzoyl)azanide;tungsten?
The IUPAC name of (2-formyloxybenzoyl)azanide;tungsten (CID 155629345) is (2-formyloxybenzoyl)azanide;tungsten.
What is the SMILES notation for (2-formyloxybenzoyl)azanide;tungsten?
The canonical SMILES for (2-formyloxybenzoyl)azanide;tungsten is [NH-]C(=O)c1ccccc1OC=O.[W].
What is the InChIKey of (2-formyloxybenzoyl)azanide;tungsten?
The InChIKey is KXQQVAYHWJEFMS-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H7NO3.W/c9-8(11)6-3-1-2-4-7(6)12-5-10;/h1-5H,(H2,9,11);/p-1.
What are the key properties of (2-formyloxybenzoyl)azanide;tungsten?
(2-formyloxybenzoyl)azanide;tungsten has a molecular weight of 347.98 g/mol, XLogP of 1.41, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-formyloxybenzoyl)azanide;tungsten is sourced from PubChem (CID 155629345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).