C32H34N2O2P2 — CID 88556678
N',N'-bis(2-diphenylphosphanylethyl)butanediamide (PubChem CID 88556678) has the molecular formula C32H34N2O2P2 and a molecular weight of 540.58 g/mol. Its IUPAC name is N',N'-bis(2-diphenylphosphanylethyl)butanediamide.
| Compound Name | N',N'-bis(2-diphenylphosphanylethyl)butanediamide |
|---|---|
| PubChem CID | 88556678 |
| Molecular Formula | C32H34N2O2P2 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | N',N'-bis(2-diphenylphosphanylethyl)butanediamide |
| SMILES | NC(=O)CCC(=O)N(CCP(c1ccccc1)c1ccccc1)CCP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H34N2O2P2/c33-31(35)21-22-32(36)34(23-25-37(27-13-5-1-6-14-27)28-15-7-2-8-16-28)24-26-38(29-17-9-3-10-18-29)30-19-11-4-12-20-30/h1-20H,21-26H2,(H2,33,35) |
| InChIKey | PYIABWYJRMEZSR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|