C21H26O6 — CID 88560180
5-(6-tert-butyl-4-ethyl-3,7-dihydroxy-3,4-dihydro-2H-chromen-2-yl)benzene-1,2,3-triol (PubChem CID 88560180) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is 5-(6-tert-butyl-4-ethyl-3,7-dihydroxy-3,4-dihydro-2H-chromen-2-yl)benzene-1,2,3-triol.
| Compound Name | 5-(6-tert-butyl-4-ethyl-3,7-dihydroxy-3,4-dihydro-2H-chromen-2-yl)benzene-1,2,3-triol |
|---|---|
| PubChem CID | 88560180 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 5-(6-tert-butyl-4-ethyl-3,7-dihydroxy-3,4-dihydro-2H-chromen-2-yl)benzene-1,2,3-triol |
| SMILES | CCC1c2cc(C(C)(C)C)c(O)cc2OC(c2cc(O)c(O)c(O)c2)C1O |
| InChI | InChI=1S/C21H26O6/c1-5-11-12-8-13(21(2,3)4)14(22)9-17(12)27-20(18(11)25)10-6-15(23)19(26)16(24)7-10/h6-9,11,18,20,22-26H,5H2,1-4H3 |
| InChIKey | CIGPZGWJTFWAQG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|