C31H51N3O3 — CID 88562937
[(3S,4aR,7R,8R,8aS,10aS)-8-[2-[(3E,6R)-3-hydroxyimino-2,2,6-trimethylcyclohexyl]ethyl]-3,7,8,8a,10a-pentamethyl-6-oxo-2,4,4a,7,9,10-hexahydro-1H-phenanthren-3-yl]urea (PubChem CID 88562937) has the molecular formula C31H51N3O3 and a molecular weight of 513.77 g/mol. Its IUPAC name is [(3S,4aR,7R,8R,8aS,10aS)-8-[2-[(3E,6R)-3-hydroxyimino-2,2,6-trimethylcyclohexyl]ethyl]-3,7,8,8a,10a-pentamethyl-6-oxo-2,4,4a,7,9,10-hexahydro-1H-phenanthren-3-yl]urea.
| Compound Name | [(3S,4aR,7R,8R,8aS,10aS)-8-[2-[(3E,6R)-3-hydroxyimino-2,2,6-trimethylcyclohexyl]ethyl]-3,7,8,8a,10a-pentamethyl-6-oxo-2,4,4a,7,9,10-hexahydro-1H-phenanthren-3-yl]urea |
|---|---|
| PubChem CID | 88562937 |
| Molecular Formula | C31H51N3O3 |
| Molecular Weight | 513.77 g/mol |
| Exact Mass | 513.39 |
| IUPAC Name | [(3S,4aR,7R,8R,8aS,10aS)-8-[2-[(3E,6R)-3-hydroxyimino-2,2,6-trimethylcyclohexyl]ethyl]-3,7,8,8a,10a-pentamethyl-6-oxo-2,4,4a,7,9,10-hexahydro-1H-phenanthren-3-yl]urea |
| SMILES | C[C@@H]1CC/C(=N\O)C(C)(C)C1CC[C@]1(C)[C@@H](C)C(=O)C=C2[C@@H]3C[C@@](C)(NC(N)=O)CC[C@]3(C)CC[C@]21C |
| InChI | InChI=1S/C31H51N3O3/c1-19-9-10-25(34-37)27(3,4)21(19)11-12-30(7)20(2)24(35)17-22-23-18-29(6,33-26(32)36)15-13-28(23,5)14-16-31(22,30)8/h17,19-21,23,37H,9-16,18H2,1-8H3,(H3,32,33,36)/b34-25+/t19-,20+,21?,23+,28-,29+,30-,31-/m1/s1 |
| InChIKey | KJZUHTLBQYEFSN-MSRSYWNFSA-N |
| XLogP | 6.85 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.77 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|