About (4R)-6-bromohept-6-ene-1,4-diol
(4R)-6-bromohept-6-ene-1,4-diol (PubChem CID 88566902) has the molecular formula C7H13BrO2
and a molecular weight of 209.08 g/mol. Its IUPAC name is (4R)-6-bromohept-6-ene-1,4-diol.
Molecular Properties
| Compound Name | (4R)-6-bromohept-6-ene-1,4-diol |
| PubChem CID | 88566902 |
| Molecular Formula | C7H13BrO2 |
| Molecular Weight | 209.08 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | (4R)-6-bromohept-6-ene-1,4-diol |
| SMILES | C=C(Br)C[C@H](O)CCCO |
| InChI | InChI=1S/C7H13BrO2/c1-6(8)5-7(10)3-2-4-9/h7,9-10H,1-5H2/t7-/m1/s1 |
| InChIKey | YKWCPKBKBKJTAZ-SSDOTTSWSA-N |
| XLogP | 1.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.08 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-6-bromohept-6-ene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-6-bromohept-6-ene-1,4-diol?
The IUPAC name of (4R)-6-bromohept-6-ene-1,4-diol (CID 88566902) is (4R)-6-bromohept-6-ene-1,4-diol.
What is the SMILES notation for (4R)-6-bromohept-6-ene-1,4-diol?
The canonical SMILES for (4R)-6-bromohept-6-ene-1,4-diol is C=C(Br)C[C@H](O)CCCO.
What is the InChIKey of (4R)-6-bromohept-6-ene-1,4-diol?
The InChIKey is YKWCPKBKBKJTAZ-SSDOTTSWSA-N. The full InChI is InChI=1S/C7H13BrO2/c1-6(8)5-7(10)3-2-4-9/h7,9-10H,1-5H2/t7-/m1/s1.
What are the key properties of (4R)-6-bromohept-6-ene-1,4-diol?
(4R)-6-bromohept-6-ene-1,4-diol has a molecular weight of 209.08 g/mol, XLogP of 1.42, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-6-bromohept-6-ene-1,4-diol is sourced from PubChem (CID 88566902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).