C16H26O8 — CID 88718722
4,7-dihydroxy-2-methylideneheptanoic acid;bis(2-methylprop-2-enoic acid) (PubChem CID 88718722) has the molecular formula C16H26O8 and a molecular weight of 346.38 g/mol. Its IUPAC name is 4,7-dihydroxy-2-methylideneheptanoic acid;bis(2-methylprop-2-enoic acid).
| Compound Name | 4,7-dihydroxy-2-methylideneheptanoic acid;bis(2-methylprop-2-enoic acid) |
|---|---|
| PubChem CID | 88718722 |
| Molecular Formula | C16H26O8 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 4,7-dihydroxy-2-methylideneheptanoic acid;bis(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.C=C(CC(O)CCCO)C(=O)O |
| InChI | InChI=1S/C8H14O4.2C4H6O2/c1-6(8(11)12)5-7(10)3-2-4-9;2*1-3(2)4(5)6/h7,9-10H,1-5H2,(H,11,12);2*1H2,2H3,(H,5,6) |
| InChIKey | BKDSPGKUGPIFNO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|