C23H29ClN6O4 — CID 88572066
6-chloro-5-[(4-hydroxycyclohexyl)amino]-3-[3-methoxy-4-(4-oxopiperidin-1-yl)anilino]pyrazine-2-carboxamide (PubChem CID 88572066) has the molecular formula C23H29ClN6O4 and a molecular weight of 488.98 g/mol. Its IUPAC name is 6-chloro-5-[(4-hydroxycyclohexyl)amino]-3-[3-methoxy-4-(4-oxopiperidin-1-yl)anilino]pyrazine-2-carboxamide.
| Compound Name | 6-chloro-5-[(4-hydroxycyclohexyl)amino]-3-[3-methoxy-4-(4-oxopiperidin-1-yl)anilino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 88572066 |
| Molecular Formula | C23H29ClN6O4 |
| Molecular Weight | 488.98 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 6-chloro-5-[(4-hydroxycyclohexyl)amino]-3-[3-methoxy-4-(4-oxopiperidin-1-yl)anilino]pyrazine-2-carboxamide |
| SMILES | COc1cc(Nc2nc(NC3CCC(O)CC3)c(Cl)nc2C(N)=O)ccc1N1CCC(=O)CC1 |
| InChI | InChI=1S/C23H29ClN6O4/c1-34-18-12-14(4-7-17(18)30-10-8-16(32)9-11-30)27-22-19(21(25)33)28-20(24)23(29-22)26-13-2-5-15(31)6-3-13/h4,7,12-13,15,31H,2-3,5-6,8-11H2,1H3,(H2,25,33)(H2,26,27,29) |
| InChIKey | PGHSGUBTQDXIJW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.98 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|