C12H17N3O3 — CID 88575477
(2R,3S)-2-amino-3-hydroxy-2-(3-hydroxypyrrolidin-1-yl)-3-pyridin-4-ylpropanal (PubChem CID 88575477) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is (2R,3S)-2-amino-3-hydroxy-2-(3-hydroxypyrrolidin-1-yl)-3-pyridin-4-ylpropanal.
| Compound Name | (2R,3S)-2-amino-3-hydroxy-2-(3-hydroxypyrrolidin-1-yl)-3-pyridin-4-ylpropanal |
|---|---|
| PubChem CID | 88575477 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (2R,3S)-2-amino-3-hydroxy-2-(3-hydroxypyrrolidin-1-yl)-3-pyridin-4-ylpropanal |
| SMILES | N[C@](C=O)([C@@H](O)c1ccncc1)N1CCC(O)C1 |
| InChI | InChI=1S/C12H17N3O3/c13-12(8-16,15-6-3-10(17)7-15)11(18)9-1-4-14-5-2-9/h1-2,4-5,8,10-11,17-18H,3,6-7,13H2/t10?,11-,12-/m0/s1 |
| InChIKey | UTRFXTMMANFKHM-RAMGSTBQSA-N |
| XLogP | -0.96 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|