C8H9F2N3O2 — CID 14976002
2,2-difluoro-3-hydroxy-3-pyridin-4-ylpropanehydrazide (PubChem CID 14976002) has the molecular formula C8H9F2N3O2 and a molecular weight of 217.18 g/mol. Its IUPAC name is 2,2-difluoro-3-hydroxy-3-pyridin-4-ylpropanehydrazide.
| Compound Name | 2,2-difluoro-3-hydroxy-3-pyridin-4-ylpropanehydrazide |
|---|---|
| PubChem CID | 14976002 |
| Molecular Formula | C8H9F2N3O2 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2,2-difluoro-3-hydroxy-3-pyridin-4-ylpropanehydrazide |
| SMILES | NNC(=O)C(F)(F)C(O)c1ccncc1 |
| InChI | InChI=1S/C8H9F2N3O2/c9-8(10,7(15)13-11)6(14)5-1-3-12-4-2-5/h1-4,6,14H,11H2,(H,13,15) |
| InChIKey | PVNZXZCVZYVLRP-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|