C9H16N3O5P — CID 70603561
2-hydrazinyl-2-methyl-1-pyridin-4-ylpropan-1-one;phosphoric acid (PubChem CID 70603561) has the molecular formula C9H16N3O5P and a molecular weight of 277.22 g/mol. Its IUPAC name is 2-hydrazinyl-2-methyl-1-pyridin-4-ylpropan-1-one;phosphoric acid.
| Compound Name | 2-hydrazinyl-2-methyl-1-pyridin-4-ylpropan-1-one;phosphoric acid |
|---|---|
| PubChem CID | 70603561 |
| Molecular Formula | C9H16N3O5P |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 2-hydrazinyl-2-methyl-1-pyridin-4-ylpropan-1-one;phosphoric acid |
| SMILES | CC(C)(NN)C(=O)c1ccncc1.O=P(O)(O)O |
| InChI | InChI=1S/C9H13N3O.H3O4P/c1-9(2,12-10)8(13)7-3-5-11-6-4-7;1-5(2,3)4/h3-6,12H,10H2,1-2H3;(H3,1,2,3,4) |
| InChIKey | OEQPVIWQYAOVKC-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|