(5-amino-8-methoxyoctyl)boronic acid

C9H22BNO3 — CID 88577036

IUPAC(5-amino-8-methoxyoctyl)boronic acid
SMILESCOCCCC(N)CCCCB(O)O
InChIInChI=1S/C9H22BNO3/c1-14-8-4-6-9(11)5-2-3-7-10(12)13/h9,12-13H,2-8,11H2,1H3
InChIKeyMLODXAXNDCUAQY-UHFFFAOYSA-N
MW203.09 g/mol
LogP0.38
Rot. Bonds9

About (5-amino-8-methoxyoctyl)boronic acid

(5-amino-8-methoxyoctyl)boronic acid (PubChem CID 88577036) has the molecular formula C9H22BNO3 and a molecular weight of 203.09 g/mol. Its IUPAC name is (5-amino-8-methoxyoctyl)boronic acid.

Molecular Properties

Compound Name(5-amino-8-methoxyoctyl)boronic acid
PubChem CID88577036
Molecular FormulaC9H22BNO3
Molecular Weight203.09 g/mol
Exact Mass203.17
IUPAC Name(5-amino-8-methoxyoctyl)boronic acid
SMILESCOCCCC(N)CCCCB(O)O
InChIInChI=1S/C9H22BNO3/c1-14-8-4-6-9(11)5-2-3-7-10(12)13/h9,12-13H,2-8,11H2,1H3
InChIKeyMLODXAXNDCUAQY-UHFFFAOYSA-N
XLogP0.38
TPSA75.71 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds9
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.09
LogP ≤ 50.38
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (5-amino-8-methoxyoctyl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5-amino-8-methoxyoctyl)boronic acid?
The IUPAC name of (5-amino-8-methoxyoctyl)boronic acid (CID 88577036) is (5-amino-8-methoxyoctyl)boronic acid.
What is the SMILES notation for (5-amino-8-methoxyoctyl)boronic acid?
The canonical SMILES for (5-amino-8-methoxyoctyl)boronic acid is COCCCC(N)CCCCB(O)O.
What is the InChIKey of (5-amino-8-methoxyoctyl)boronic acid?
The InChIKey is MLODXAXNDCUAQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22BNO3/c1-14-8-4-6-9(11)5-2-3-7-10(12)13/h9,12-13H,2-8,11H2,1H3.
What are the key properties of (5-amino-8-methoxyoctyl)boronic acid?
(5-amino-8-methoxyoctyl)boronic acid has a molecular weight of 203.09 g/mol, XLogP of 0.38, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-8-methoxyoctyl)boronic acid is sourced from PubChem (CID 88577036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).