About [(5R)-5-amino-7-[ethyl(2-hydroxyethyl)amino]heptyl]boronic acid;carbon dioxide
[(5R)-5-amino-7-[ethyl(2-hydroxyethyl)amino]heptyl]boronic acid;carbon dioxide (PubChem CID 158457842) has the molecular formula C12H27BN2O5
and a molecular weight of 290.17 g/mol. Its IUPAC name is [(5R)-5-amino-7-[ethyl(2-hydroxyethyl)amino]heptyl]boronic acid;carbon dioxide.
Molecular Properties
| Compound Name | [(5R)-5-amino-7-[ethyl(2-hydroxyethyl)amino]heptyl]boronic acid;carbon dioxide |
| PubChem CID | 158457842 |
| Molecular Formula | C12H27BN2O5 |
| Molecular Weight | 290.17 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | [(5R)-5-amino-7-[ethyl(2-hydroxyethyl)amino]heptyl]boronic acid;carbon dioxide |
| SMILES | CCN(CCO)CC[C@H](N)CCCCB(O)O.O=C=O |
| InChI | InChI=1S/C11H27BN2O3.CO2/c1-2-14(9-10-15)8-6-11(13)5-3-4-7-12(16)17;2-1-3/h11,15-17H,2-10,13H2,1H3;/t11-;/m1./s1 |
| InChIKey | HEUHBWMHZQQKMU-RFVHGSKJSA-N |
| XLogP | -0.92 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.17 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(5R)-5-amino-7-[ethyl(2-hydroxyethyl)amino]heptyl]boronic acid;carbon dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5R)-5-amino-7-[ethyl(2-hydroxyethyl)amino]heptyl]boronic acid;carbon dioxide?
The IUPAC name of [(5R)-5-amino-7-[ethyl(2-hydroxyethyl)amino]heptyl]boronic acid;carbon dioxide (CID 158457842) is [(5R)-5-amino-7-[ethyl(2-hydroxyethyl)amino]heptyl]boronic acid;carbon dioxide.
What is the SMILES notation for [(5R)-5-amino-7-[ethyl(2-hydroxyethyl)amino]heptyl]boronic acid;carbon dioxide?
The canonical SMILES for [(5R)-5-amino-7-[ethyl(2-hydroxyethyl)amino]heptyl]boronic acid;carbon dioxide is CCN(CCO)CC[C@H](N)CCCCB(O)O.O=C=O.
What is the InChIKey of [(5R)-5-amino-7-[ethyl(2-hydroxyethyl)amino]heptyl]boronic acid;carbon dioxide?
The InChIKey is HEUHBWMHZQQKMU-RFVHGSKJSA-N. The full InChI is InChI=1S/C11H27BN2O3.CO2/c1-2-14(9-10-15)8-6-11(13)5-3-4-7-12(16)17;2-1-3/h11,15-17H,2-10,13H2,1H3;/t11-;/m1./s1.
What are the key properties of [(5R)-5-amino-7-[ethyl(2-hydroxyethyl)amino]heptyl]boronic acid;carbon dioxide?
[(5R)-5-amino-7-[ethyl(2-hydroxyethyl)amino]heptyl]boronic acid;carbon dioxide has a molecular weight of 290.17 g/mol, XLogP of -0.92, 11 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(5R)-5-amino-7-[ethyl(2-hydroxyethyl)amino]heptyl]boronic acid;carbon dioxide is sourced from PubChem (CID 158457842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).