C28H26N2O4S — CID 88589491
benzyl [2-methyl-4-[[2-(3-phenylpropanoylamino)-1,3-thiazol-5-yl]methyl]phenyl] carbonate (PubChem CID 88589491) has the molecular formula C28H26N2O4S and a molecular weight of 486.59 g/mol. Its IUPAC name is benzyl [2-methyl-4-[[2-(3-phenylpropanoylamino)-1,3-thiazol-5-yl]methyl]phenyl] carbonate.
| Compound Name | benzyl [2-methyl-4-[[2-(3-phenylpropanoylamino)-1,3-thiazol-5-yl]methyl]phenyl] carbonate |
|---|---|
| PubChem CID | 88589491 |
| Molecular Formula | C28H26N2O4S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | benzyl [2-methyl-4-[[2-(3-phenylpropanoylamino)-1,3-thiazol-5-yl]methyl]phenyl] carbonate |
| SMILES | Cc1cc(Cc2cnc(NC(=O)CCc3ccccc3)s2)ccc1OC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H26N2O4S/c1-20-16-23(12-14-25(20)34-28(32)33-19-22-10-6-3-7-11-22)17-24-18-29-27(35-24)30-26(31)15-13-21-8-4-2-5-9-21/h2-12,14,16,18H,13,15,17,19H2,1H3,(H,29,30,31) |
| InChIKey | XNTMRGWAQJDFJK-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|