C27H25N3O4S — CID 88589492
benzyl [2-methyl-4-[[2-(3-pyridin-3-ylpropanoylamino)-1,3-thiazol-5-yl]methyl]phenyl] carbonate (PubChem CID 88589492) has the molecular formula C27H25N3O4S and a molecular weight of 487.58 g/mol. Its IUPAC name is benzyl [2-methyl-4-[[2-(3-pyridin-3-ylpropanoylamino)-1,3-thiazol-5-yl]methyl]phenyl] carbonate.
| Compound Name | benzyl [2-methyl-4-[[2-(3-pyridin-3-ylpropanoylamino)-1,3-thiazol-5-yl]methyl]phenyl] carbonate |
|---|---|
| PubChem CID | 88589492 |
| Molecular Formula | C27H25N3O4S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | benzyl [2-methyl-4-[[2-(3-pyridin-3-ylpropanoylamino)-1,3-thiazol-5-yl]methyl]phenyl] carbonate |
| SMILES | Cc1cc(Cc2cnc(NC(=O)CCc3cccnc3)s2)ccc1OC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H25N3O4S/c1-19-14-22(9-11-24(19)34-27(32)33-18-21-6-3-2-4-7-21)15-23-17-29-26(35-23)30-25(31)12-10-20-8-5-13-28-16-20/h2-9,11,13-14,16-17H,10,12,15,18H2,1H3,(H,29,30,31) |
| InChIKey | IVQYFQAZOKOVRF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|