C24H32Si — CID 88592987
butyl-methyl-(2-methyl-1H-inden-1-yl)-(2,4,6-trimethylphenyl)silane (PubChem CID 88592987) has the molecular formula C24H32Si and a molecular weight of 348.61 g/mol. Its IUPAC name is butyl-methyl-(2-methyl-1H-inden-1-yl)-(2,4,6-trimethylphenyl)silane.
| Compound Name | butyl-methyl-(2-methyl-1H-inden-1-yl)-(2,4,6-trimethylphenyl)silane |
|---|---|
| PubChem CID | 88592987 |
| Molecular Formula | C24H32Si |
| Molecular Weight | 348.61 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | butyl-methyl-(2-methyl-1H-inden-1-yl)-(2,4,6-trimethylphenyl)silane |
| SMILES | CCCC[Si](C)(c1c(C)cc(C)cc1C)C1C(C)=Cc2ccccc21 |
| InChI | InChI=1S/C24H32Si/c1-7-8-13-25(6,23-18(3)14-17(2)15-19(23)4)24-20(5)16-21-11-9-10-12-22(21)24/h9-12,14-16,24H,7-8,13H2,1-6H3 |
| InChIKey | RVWKNJJHMIFGQJ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.61 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|